C27H25N3O6 — CID 18423296
methyl 2-[4-[[3-[4-(N'-benzoylcarbamimidoyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methoxy]phenyl]acetate (PubChem CID 18423296) has the molecular formula C27H25N3O6 and a molecular weight of 487.51 g/mol. Its IUPAC name is methyl 2-[4-[[3-[4-(N'-benzoylcarbamimidoyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methoxy]phenyl]acetate.
| Compound Name | methyl 2-[4-[[3-[4-(N'-benzoylcarbamimidoyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 18423296 |
| Molecular Formula | C27H25N3O6 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | methyl 2-[4-[[3-[4-(N'-benzoylcarbamimidoyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methoxy]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(OCC2CN(c3ccc(/C(N)=N/C(=O)c4ccccc4)cc3)C(=O)O2)cc1 |
| InChI | InChI=1S/C27H25N3O6/c1-34-24(31)15-18-7-13-22(14-8-18)35-17-23-16-30(27(33)36-23)21-11-9-19(10-12-21)25(28)29-26(32)20-5-3-2-4-6-20/h2-14,23H,15-17H2,1H3,(H2,28,29,32) |
| InChIKey | PWJHJPITDDFVDL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|