C19H18ClN3O6S — CID 22435189
[3-[4-[N'-(4-chlorobenzoyl)carbamimidoyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate (PubChem CID 22435189) has the molecular formula C19H18ClN3O6S and a molecular weight of 451.89 g/mol. Its IUPAC name is [3-[4-[N'-(4-chlorobenzoyl)carbamimidoyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate.
| Compound Name | [3-[4-[N'-(4-chlorobenzoyl)carbamimidoyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 22435189 |
| Molecular Formula | C19H18ClN3O6S |
| Molecular Weight | 451.89 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | [3-[4-[N'-(4-chlorobenzoyl)carbamimidoyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC1CN(c2ccc(/C(N)=N/C(=O)c3ccc(Cl)cc3)cc2)C(=O)O1 |
| InChI | InChI=1S/C19H18ClN3O6S/c1-30(26,27)28-11-16-10-23(19(25)29-16)15-8-4-12(5-9-15)17(21)22-18(24)13-2-6-14(20)7-3-13/h2-9,16H,10-11H2,1H3,(H2,21,22,24) |
| InChIKey | MWLCPBZLOBUMCC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.89 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|