C20H22IN3O5 — CID 139662327
methyl 2-[3-[[3-(4-carbamimidoylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methoxy]phenyl]acetate;hydroiodide (PubChem CID 139662327) has the molecular formula C20H22IN3O5 and a molecular weight of 511.32 g/mol. Its IUPAC name is methyl 2-[3-[[3-(4-carbamimidoylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methoxy]phenyl]acetate;hydroiodide.
| Compound Name | methyl 2-[3-[[3-(4-carbamimidoylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methoxy]phenyl]acetate;hydroiodide |
|---|---|
| PubChem CID | 139662327 |
| Molecular Formula | C20H22IN3O5 |
| Molecular Weight | 511.32 g/mol |
| Exact Mass | 511.06 |
| IUPAC Name | methyl 2-[3-[[3-(4-carbamimidoylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methoxy]phenyl]acetate;hydroiodide |
| SMILES | I.[H]/N=C(\N)c1ccc(N2CC(COc3cccc(CC(=O)OC)c3)OC2=O)cc1 |
| InChI | InChI=1S/C20H21N3O5.HI/c1-26-18(24)10-13-3-2-4-16(9-13)27-12-17-11-23(20(25)28-17)15-7-5-14(6-8-15)19(21)22;/h2-9,17H,10-12H2,1H3,(H3,21,22);1H |
| InChIKey | AUXQIEYLELMHLB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|