C25H24N4O5 — CID 91531422
3-[[3-(3-carbamimidoylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methoxy]-N-(4-methoxyphenyl)benzamide (PubChem CID 91531422) has the molecular formula C25H24N4O5 and a molecular weight of 460.49 g/mol. Its IUPAC name is 3-[[3-(3-carbamimidoylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methoxy]-N-(4-methoxyphenyl)benzamide.
| Compound Name | 3-[[3-(3-carbamimidoylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methoxy]-N-(4-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 91531422 |
| Molecular Formula | C25H24N4O5 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 3-[[3-(3-carbamimidoylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methoxy]-N-(4-methoxyphenyl)benzamide |
| SMILES | [H]/N=C(\N)c1cccc(N2CC(COc3cccc(C(=O)Nc4ccc(OC)cc4)c3)OC2=O)c1 |
| InChI | InChI=1S/C25H24N4O5/c1-32-20-10-8-18(9-11-20)28-24(30)17-5-3-7-21(13-17)33-15-22-14-29(25(31)34-22)19-6-2-4-16(12-19)23(26)27/h2-13,22H,14-15H2,1H3,(H3,26,27)(H,28,30) |
| InChIKey | BEBUZNINELQTLT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 126.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|