C23H26Cl2N4O3 — CID 10195577
3-[5-[[2,4-dichloro-6-(piperidin-1-ylmethyl)phenoxy]methyl]-2-oxo-1,3-oxazolidin-3-yl]benzenecarboximidamide (PubChem CID 10195577) has the molecular formula C23H26Cl2N4O3 and a molecular weight of 477.39 g/mol. Its IUPAC name is 3-[5-[[2,4-dichloro-6-(piperidin-1-ylmethyl)phenoxy]methyl]-2-oxo-1,3-oxazolidin-3-yl]benzenecarboximidamide.
| Compound Name | 3-[5-[[2,4-dichloro-6-(piperidin-1-ylmethyl)phenoxy]methyl]-2-oxo-1,3-oxazolidin-3-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 10195577 |
| Molecular Formula | C23H26Cl2N4O3 |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 3-[5-[[2,4-dichloro-6-(piperidin-1-ylmethyl)phenoxy]methyl]-2-oxo-1,3-oxazolidin-3-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(N2CC(COc3c(Cl)cc(Cl)cc3CN3CCCCC3)OC2=O)c1 |
| InChI | InChI=1S/C23H26Cl2N4O3/c24-17-9-16(12-28-7-2-1-3-8-28)21(20(25)11-17)31-14-19-13-29(23(30)32-19)18-6-4-5-15(10-18)22(26)27/h4-6,9-11,19H,1-3,7-8,12-14H2,(H3,26,27) |
| InChIKey | RWIRLBFLIUHHIX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 91.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|