C21H26N4O4S — CID 70086159
3-[2-oxo-5-[[(4-propan-2-ylphenyl)sulfonylmethylamino]methyl]-1,3-oxazolidin-3-yl]benzenecarboximidamide (PubChem CID 70086159) has the molecular formula C21H26N4O4S and a molecular weight of 430.53 g/mol. Its IUPAC name is 3-[2-oxo-5-[[(4-propan-2-ylphenyl)sulfonylmethylamino]methyl]-1,3-oxazolidin-3-yl]benzenecarboximidamide.
| Compound Name | 3-[2-oxo-5-[[(4-propan-2-ylphenyl)sulfonylmethylamino]methyl]-1,3-oxazolidin-3-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 70086159 |
| Molecular Formula | C21H26N4O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 3-[2-oxo-5-[[(4-propan-2-ylphenyl)sulfonylmethylamino]methyl]-1,3-oxazolidin-3-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(N2CC(CNCS(=O)(=O)c3ccc(C(C)C)cc3)OC2=O)c1 |
| InChI | InChI=1S/C21H26N4O4S/c1-14(2)15-6-8-19(9-7-15)30(27,28)13-24-11-18-12-25(21(26)29-18)17-5-3-4-16(10-17)20(22)23/h3-10,14,18,24H,11-13H2,1-2H3,(H3,22,23) |
| InChIKey | HXZJDCYNIZZTOF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 125.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|