C22H27N5O4S — CID 54229728
4-[5-[[4-(benzenesulfonamido)piperidin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]benzenecarboximidamide (PubChem CID 54229728) has the molecular formula C22H27N5O4S and a molecular weight of 457.56 g/mol. Its IUPAC name is 4-[5-[[4-(benzenesulfonamido)piperidin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]benzenecarboximidamide.
| Compound Name | 4-[5-[[4-(benzenesulfonamido)piperidin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 54229728 |
| Molecular Formula | C22H27N5O4S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 4-[5-[[4-(benzenesulfonamido)piperidin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N2CC(CN3CCC(NS(=O)(=O)c4ccccc4)CC3)OC2=O)cc1 |
| InChI | InChI=1S/C22H27N5O4S/c23-21(24)16-6-8-18(9-7-16)27-15-19(31-22(27)28)14-26-12-10-17(11-13-26)25-32(29,30)20-4-2-1-3-5-20/h1-9,17,19,25H,10-15H2,(H3,23,24) |
| InChIKey | QIJWOBQORHHTPB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 128.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|