C15H21N5O2 — CID 22078396
4-[2-oxo-5-(piperazin-1-ylmethyl)-1,3-oxazolidin-3-yl]benzenecarboximidamide (PubChem CID 22078396) has the molecular formula C15H21N5O2 and a molecular weight of 303.37 g/mol. Its IUPAC name is 4-[2-oxo-5-(piperazin-1-ylmethyl)-1,3-oxazolidin-3-yl]benzenecarboximidamide.
| Compound Name | 4-[2-oxo-5-(piperazin-1-ylmethyl)-1,3-oxazolidin-3-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 22078396 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 4-[2-oxo-5-(piperazin-1-ylmethyl)-1,3-oxazolidin-3-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N2CC(CN3CCNCC3)OC2=O)cc1 |
| InChI | InChI=1S/C15H21N5O2/c16-14(17)11-1-3-12(4-2-11)20-10-13(22-15(20)21)9-19-7-5-18-6-8-19/h1-4,13,18H,5-10H2,(H3,16,17) |
| InChIKey | GPHGFSHQVCXYMM-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|