C23H28N6O8S — CID 162332245
acetic acid;4-[5-[[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]benzenecarboximidamide (PubChem CID 162332245) has the molecular formula C23H28N6O8S and a molecular weight of 548.58 g/mol. Its IUPAC name is acetic acid;4-[5-[[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]benzenecarboximidamide.
| Compound Name | acetic acid;4-[5-[[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 162332245 |
| Molecular Formula | C23H28N6O8S |
| Molecular Weight | 548.58 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | acetic acid;4-[5-[[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]benzenecarboximidamide |
| SMILES | CC(=O)O.[H]/N=C(\N)c1ccc(N2CC(CN3CCN(S(=O)(=O)c4ccc([N+](=O)[O-])cc4)CC3)OC2=O)cc1 |
| InChI | InChI=1S/C21H24N6O6S.C2H4O2/c22-20(23)15-1-3-16(4-2-15)26-14-18(33-21(26)28)13-24-9-11-25(12-10-24)34(31,32)19-7-5-17(6-8-19)27(29)30;1-2(3)4/h1-8,18H,9-14H2,(H3,22,23);1H3,(H,3,4) |
| InChIKey | RSKWFRVWYYBRHY-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 200.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.58 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|