C21H22F3N5O4S — CID 54533195
4-[2-oxo-5-[[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]methyl]-1,3-oxazolidin-3-yl]benzenecarboximidamide (PubChem CID 54533195) has the molecular formula C21H22F3N5O4S and a molecular weight of 497.50 g/mol. Its IUPAC name is 4-[2-oxo-5-[[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]methyl]-1,3-oxazolidin-3-yl]benzenecarboximidamide.
| Compound Name | 4-[2-oxo-5-[[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]methyl]-1,3-oxazolidin-3-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 54533195 |
| Molecular Formula | C21H22F3N5O4S |
| Molecular Weight | 497.50 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 4-[2-oxo-5-[[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]methyl]-1,3-oxazolidin-3-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N2CC(CN3CCN(S(=O)(=O)c4ccc(F)c(F)c4F)CC3)OC2=O)cc1 |
| InChI | InChI=1S/C21H22F3N5O4S/c22-16-5-6-17(19(24)18(16)23)34(31,32)28-9-7-27(8-10-28)11-15-12-29(21(30)33-15)14-3-1-13(2-4-14)20(25)26/h1-6,15H,7-12H2,(H3,25,26) |
| InChIKey | YXYVXHTXEXYGTC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.50 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|