C19H25N5O6 — CID 19956112
2-[4-[[3-(4-carbamimidoylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]butanedioic acid (PubChem CID 19956112) has the molecular formula C19H25N5O6 and a molecular weight of 419.44 g/mol. Its IUPAC name is 2-[4-[[3-(4-carbamimidoylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]butanedioic acid.
| Compound Name | 2-[4-[[3-(4-carbamimidoylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]butanedioic acid |
|---|---|
| PubChem CID | 19956112 |
| Molecular Formula | C19H25N5O6 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 2-[4-[[3-(4-carbamimidoylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]butanedioic acid |
| SMILES | [H]/N=C(\N)c1ccc(N2CC(CN3CCN(C(CC(=O)O)C(=O)O)CC3)OC2=O)cc1 |
| InChI | InChI=1S/C19H25N5O6/c20-17(21)12-1-3-13(4-2-12)24-11-14(30-19(24)29)10-22-5-7-23(8-6-22)15(18(27)28)9-16(25)26/h1-4,14-15H,5-11H2,(H3,20,21)(H,25,26)(H,27,28) |
| InChIKey | BPOXSTAXBWQVFN-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 160.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|