C30H36ClN5O7 — CID 151004291
diethyl 2-[4-[[3-[4-(N-benzoyl-N-chlorocarbamimidoyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]butanedioate (PubChem CID 151004291) has the molecular formula C30H36ClN5O7 and a molecular weight of 614.10 g/mol. Its IUPAC name is diethyl 2-[4-[[3-[4-(N-benzoyl-N-chlorocarbamimidoyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]butanedioate.
| Compound Name | diethyl 2-[4-[[3-[4-(N-benzoyl-N-chlorocarbamimidoyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]butanedioate |
|---|---|
| PubChem CID | 151004291 |
| Molecular Formula | C30H36ClN5O7 |
| Molecular Weight | 614.10 g/mol |
| Exact Mass | 613.23 |
| IUPAC Name | diethyl 2-[4-[[3-[4-(N-benzoyl-N-chlorocarbamimidoyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]butanedioate |
| SMILES | [H]/N=C(/c1ccc(N2CC(CN3CCN(C(CC(=O)OCC)C(=O)OCC)CC3)OC2=O)cc1)N(Cl)C(=O)c1ccccc1 |
| InChI | InChI=1S/C30H36ClN5O7/c1-3-41-26(37)18-25(29(39)42-4-2)34-16-14-33(15-17-34)19-24-20-35(30(40)43-24)23-12-10-21(11-13-23)27(32)36(31)28(38)22-8-6-5-7-9-22/h5-13,24-25,32H,3-4,14-20H2,1-2H3/b32-27- |
| InChIKey | LUTLZXGBWHKGMR-MXNGAVTRSA-N |
| XLogP | 3.14 |
| TPSA | 132.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.10 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|