C23H32N6O7 — CID 173218459
methyl 2-[4-[[3-[4-[N-[ethoxycarbonyl(methyl)carbamoyl]carbamimidoyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]acetate (PubChem CID 173218459) has the molecular formula C23H32N6O7 and a molecular weight of 504.54 g/mol. Its IUPAC name is methyl 2-[4-[[3-[4-[N-[ethoxycarbonyl(methyl)carbamoyl]carbamimidoyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]acetate.
| Compound Name | methyl 2-[4-[[3-[4-[N-[ethoxycarbonyl(methyl)carbamoyl]carbamimidoyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 173218459 |
| Molecular Formula | C23H32N6O7 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | methyl 2-[4-[[3-[4-[N-[ethoxycarbonyl(methyl)carbamoyl]carbamimidoyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]acetate |
| SMILES | [H]/N=C(\NC(=O)N(C)C(=O)OCC)c1ccc(N2CC(CN3CCN(CC(=O)OC)CC3)OC2=O)cc1 |
| InChI | InChI=1S/C23H32N6O7/c1-4-35-22(32)26(2)21(31)25-20(24)16-5-7-17(8-6-16)29-14-18(36-23(29)33)13-27-9-11-28(12-10-27)15-19(30)34-3/h5-8,18H,4,9-15H2,1-3H3,(H2,24,25,31) |
| InChIKey | DANIHBDJSOSMAJ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 144.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|