C21H29N5O6 — CID 142654628
[4-[(5R)-2-oxo-5-[[4-(2-oxo-2-propoxyethyl)piperazin-1-yl]methyl]-1,3-oxazolidin-3-yl]benzenecarboximidoyl]carbamic acid (PubChem CID 142654628) has the molecular formula C21H29N5O6 and a molecular weight of 447.49 g/mol. Its IUPAC name is [4-[(5R)-2-oxo-5-[[4-(2-oxo-2-propoxyethyl)piperazin-1-yl]methyl]-1,3-oxazolidin-3-yl]benzenecarboximidoyl]carbamic acid.
| Compound Name | [4-[(5R)-2-oxo-5-[[4-(2-oxo-2-propoxyethyl)piperazin-1-yl]methyl]-1,3-oxazolidin-3-yl]benzenecarboximidoyl]carbamic acid |
|---|---|
| PubChem CID | 142654628 |
| Molecular Formula | C21H29N5O6 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | [4-[(5R)-2-oxo-5-[[4-(2-oxo-2-propoxyethyl)piperazin-1-yl]methyl]-1,3-oxazolidin-3-yl]benzenecarboximidoyl]carbamic acid |
| SMILES | [H]/N=C(\NC(=O)O)c1ccc(N2C[C@@H](CN3CCN(CC(=O)OCCC)CC3)OC2=O)cc1 |
| InChI | InChI=1S/C21H29N5O6/c1-2-11-31-18(27)14-25-9-7-24(8-10-25)12-17-13-26(21(30)32-17)16-5-3-15(4-6-16)19(22)23-20(28)29/h3-6,17H,2,7-14H2,1H3,(H2,22,23)(H,28,29)/t17-/m1/s1 |
| InChIKey | FVKDKMMIWAKRHS-QGZVFWFLSA-N |
| XLogP | 1.18 |
| TPSA | 135.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|