C25H31N5O6 — CID 173218373
ethyl 2-[4-[[3-[4-[N-(furan-2-carbonyl)carbamimidoyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]propanoate (PubChem CID 173218373) has the molecular formula C25H31N5O6 and a molecular weight of 497.55 g/mol. Its IUPAC name is ethyl 2-[4-[[3-[4-[N-(furan-2-carbonyl)carbamimidoyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]propanoate.
| Compound Name | ethyl 2-[4-[[3-[4-[N-(furan-2-carbonyl)carbamimidoyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 173218373 |
| Molecular Formula | C25H31N5O6 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | ethyl 2-[4-[[3-[4-[N-(furan-2-carbonyl)carbamimidoyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]propanoate |
| SMILES | [H]/N=C(\NC(=O)c1ccco1)c1ccc(N2CC(CN3CCN(C(C)C(=O)OCC)CC3)OC2=O)cc1 |
| InChI | InChI=1S/C25H31N5O6/c1-3-34-24(32)17(2)29-12-10-28(11-13-29)15-20-16-30(25(33)36-20)19-8-6-18(7-9-19)22(26)27-23(31)21-5-4-14-35-21/h4-9,14,17,20H,3,10-13,15-16H2,1-2H3,(H2,26,27,31) |
| InChIKey | FICVWBBCLQNBAA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 128.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|