C25H29N5O7 — CID 70051457
ethyl 2-[4-[[3-[4-[N'-(furan-2-carbonyl)carbamimidoyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-oxopiperazin-1-yl]propanoate (PubChem CID 70051457) has the molecular formula C25H29N5O7 and a molecular weight of 511.54 g/mol. Its IUPAC name is ethyl 2-[4-[[3-[4-[N'-(furan-2-carbonyl)carbamimidoyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-oxopiperazin-1-yl]propanoate.
| Compound Name | ethyl 2-[4-[[3-[4-[N'-(furan-2-carbonyl)carbamimidoyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-oxopiperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 70051457 |
| Molecular Formula | C25H29N5O7 |
| Molecular Weight | 511.54 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | ethyl 2-[4-[[3-[4-[N'-(furan-2-carbonyl)carbamimidoyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-oxopiperazin-1-yl]propanoate |
| SMILES | CCOC(=O)C(C)N1CCN(CC2CN(c3ccc(/C(N)=N/C(=O)c4ccco4)cc3)C(=O)O2)CC1=O |
| InChI | InChI=1S/C25H29N5O7/c1-3-35-24(33)16(2)29-11-10-28(15-21(29)31)13-19-14-30(25(34)37-19)18-8-6-17(7-9-18)22(26)27-23(32)20-5-4-12-36-20/h4-9,12,16,19H,3,10-11,13-15H2,1-2H3,(H2,26,27,32) |
| InChIKey | WWQCRBNQZDRIBV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 147.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.54 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|