C24H28N4O6 — CID 18423219
ethyl 1-[[3-[4-[N'-(furan-2-carbonyl)carbamimidoyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperidine-4-carboxylate (PubChem CID 18423219) has the molecular formula C24H28N4O6 and a molecular weight of 468.51 g/mol. Its IUPAC name is ethyl 1-[[3-[4-[N'-(furan-2-carbonyl)carbamimidoyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[[3-[4-[N'-(furan-2-carbonyl)carbamimidoyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 18423219 |
| Molecular Formula | C24H28N4O6 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | ethyl 1-[[3-[4-[N'-(furan-2-carbonyl)carbamimidoyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(CC2CN(c3ccc(/C(N)=N/C(=O)c4ccco4)cc3)C(=O)O2)CC1 |
| InChI | InChI=1S/C24H28N4O6/c1-2-32-23(30)17-9-11-27(12-10-17)14-19-15-28(24(31)34-19)18-7-5-16(6-8-18)21(25)26-22(29)20-4-3-13-33-20/h3-8,13,17,19H,2,9-12,14-15H2,1H3,(H2,25,26,29) |
| InChIKey | USPRYMATYXRQJI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|