C26H30N6O7 — CID 22435133
ethyl 2-[4-[[3-[4-[N'-(2-nitrobenzoyl)carbamimidoyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]acetate (PubChem CID 22435133) has the molecular formula C26H30N6O7 and a molecular weight of 538.56 g/mol. Its IUPAC name is ethyl 2-[4-[[3-[4-[N'-(2-nitrobenzoyl)carbamimidoyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[[3-[4-[N'-(2-nitrobenzoyl)carbamimidoyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 22435133 |
| Molecular Formula | C26H30N6O7 |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | ethyl 2-[4-[[3-[4-[N'-(2-nitrobenzoyl)carbamimidoyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCN(CC2CN(c3ccc(/C(N)=N/C(=O)c4ccccc4[N+](=O)[O-])cc3)C(=O)O2)CC1 |
| InChI | InChI=1S/C26H30N6O7/c1-2-38-23(33)17-30-13-11-29(12-14-30)15-20-16-31(26(35)39-20)19-9-7-18(8-10-19)24(27)28-25(34)21-5-3-4-6-22(21)32(36)37/h3-10,20H,2,11-17H2,1H3,(H2,27,28,34) |
| InChIKey | NINFBVYBDMSORY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 160.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|