C24H27N5O7 — CID 22435186
ethyl 2-[4-[[3-[4-[N'-(furan-3-carbonyl)carbamimidoyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-oxopiperazin-1-yl]acetate (PubChem CID 22435186) has the molecular formula C24H27N5O7 and a molecular weight of 497.51 g/mol. Its IUPAC name is ethyl 2-[4-[[3-[4-[N'-(furan-3-carbonyl)carbamimidoyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-oxopiperazin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[[3-[4-[N'-(furan-3-carbonyl)carbamimidoyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-oxopiperazin-1-yl]acetate |
|---|---|
| PubChem CID | 22435186 |
| Molecular Formula | C24H27N5O7 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | ethyl 2-[4-[[3-[4-[N'-(furan-3-carbonyl)carbamimidoyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-oxopiperazin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCN(CC2CN(c3ccc(/C(N)=N/C(=O)c4ccoc4)cc3)C(=O)O2)CC1=O |
| InChI | InChI=1S/C24H27N5O7/c1-2-35-21(31)14-28-9-8-27(13-20(28)30)11-19-12-29(24(33)36-19)18-5-3-16(4-6-18)22(25)26-23(32)17-7-10-34-15-17/h3-7,10,15,19H,2,8-9,11-14H2,1H3,(H2,25,26,32) |
| InChIKey | CXRRNNGWQSRQRQ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 147.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|