C22H29N5O7 — CID 70053139
ethyl 2-[4-[[3-[4-(N'-methoxycarbonylcarbamimidoyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-oxopiperazin-1-yl]propanoate (PubChem CID 70053139) has the molecular formula C22H29N5O7 and a molecular weight of 475.50 g/mol. Its IUPAC name is ethyl 2-[4-[[3-[4-(N'-methoxycarbonylcarbamimidoyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-oxopiperazin-1-yl]propanoate.
| Compound Name | ethyl 2-[4-[[3-[4-(N'-methoxycarbonylcarbamimidoyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-oxopiperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 70053139 |
| Molecular Formula | C22H29N5O7 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | ethyl 2-[4-[[3-[4-(N'-methoxycarbonylcarbamimidoyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-oxopiperazin-1-yl]propanoate |
| SMILES | CCOC(=O)C(C)N1CCN(CC2CN(c3ccc(C(N)=NC(=O)OC)cc3)C(=O)O2)CC1=O |
| InChI | InChI=1S/C22H29N5O7/c1-4-33-20(29)14(2)26-10-9-25(13-18(26)28)11-17-12-27(22(31)34-17)16-7-5-15(6-8-16)19(23)24-21(30)32-3/h5-8,14,17H,4,9-13H2,1-3H3,(H2,23,24,30) |
| InChIKey | YQJPAKPSWFKOSR-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 144.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|