C28H33N5O7 — CID 70050280
ethyl 3-[2-oxo-4-[[2-oxo-3-[4-(N'-phenylmethoxycarbonylcarbamimidoyl)phenyl]-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]propanoate (PubChem CID 70050280) has the molecular formula C28H33N5O7 and a molecular weight of 551.60 g/mol. Its IUPAC name is ethyl 3-[2-oxo-4-[[2-oxo-3-[4-(N'-phenylmethoxycarbonylcarbamimidoyl)phenyl]-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]propanoate.
| Compound Name | ethyl 3-[2-oxo-4-[[2-oxo-3-[4-(N'-phenylmethoxycarbonylcarbamimidoyl)phenyl]-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 70050280 |
| Molecular Formula | C28H33N5O7 |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | ethyl 3-[2-oxo-4-[[2-oxo-3-[4-(N'-phenylmethoxycarbonylcarbamimidoyl)phenyl]-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]propanoate |
| SMILES | CCOC(=O)CCN1CCN(CC2CN(c3ccc(C(N)=NC(=O)OCc4ccccc4)cc3)C(=O)O2)CC1=O |
| InChI | InChI=1S/C28H33N5O7/c1-2-38-25(35)12-13-32-15-14-31(18-24(32)34)16-23-17-33(28(37)40-23)22-10-8-21(9-11-22)26(29)30-27(36)39-19-20-6-4-3-5-7-20/h3-11,23H,2,12-19H2,1H3,(H2,29,30,36) |
| InChIKey | NBWLPKGANLDAAQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 144.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|