C17H18N4O5 — CID 19356314
2-[4-[[3-(4-carbamimidoylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methoxy]-1H-pyrrol-3-yl]acetic acid (PubChem CID 19356314) has the molecular formula C17H18N4O5 and a molecular weight of 358.35 g/mol. Its IUPAC name is 2-[4-[[3-(4-carbamimidoylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methoxy]-1H-pyrrol-3-yl]acetic acid.
| Compound Name | 2-[4-[[3-(4-carbamimidoylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methoxy]-1H-pyrrol-3-yl]acetic acid |
|---|---|
| PubChem CID | 19356314 |
| Molecular Formula | C17H18N4O5 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 2-[4-[[3-(4-carbamimidoylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methoxy]-1H-pyrrol-3-yl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(N2CC(COc3c[nH]cc3CC(=O)O)OC2=O)cc1 |
| InChI | InChI=1S/C17H18N4O5/c18-16(19)10-1-3-12(4-2-10)21-8-13(26-17(21)24)9-25-14-7-20-6-11(14)5-15(22)23/h1-4,6-7,13,20H,5,8-9H2,(H3,18,19)(H,22,23) |
| InChIKey | JIUKRAUKPOCKFG-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 141.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|