C21H24N4O5 — CID 18176781
methyl 2-amino-3-[4-[[3-(4-carbamimidoylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methoxy]phenyl]propanoate (PubChem CID 18176781) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is methyl 2-amino-3-[4-[[3-(4-carbamimidoylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methoxy]phenyl]propanoate.
| Compound Name | methyl 2-amino-3-[4-[[3-(4-carbamimidoylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 18176781 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | methyl 2-amino-3-[4-[[3-(4-carbamimidoylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methoxy]phenyl]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(N2CC(COc3ccc(CC(N)C(=O)OC)cc3)OC2=O)cc1 |
| InChI | InChI=1S/C21H24N4O5/c1-28-20(26)18(22)10-13-2-8-16(9-3-13)29-12-17-11-25(21(27)30-17)15-6-4-14(5-7-15)19(23)24/h2-9,17-18H,10-12,22H2,1H3,(H3,23,24) |
| InChIKey | DNWAIQSNHAAIRA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 140.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|