C25H23FN4O4 — CID 10195337
3-[[3-(4-carbamimidoylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methoxy]-N-[(3-fluorophenyl)methyl]benzamide (PubChem CID 10195337) has the molecular formula C25H23FN4O4 and a molecular weight of 462.48 g/mol. Its IUPAC name is 3-[[3-(4-carbamimidoylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methoxy]-N-[(3-fluorophenyl)methyl]benzamide.
| Compound Name | 3-[[3-(4-carbamimidoylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methoxy]-N-[(3-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 10195337 |
| Molecular Formula | C25H23FN4O4 |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 3-[[3-(4-carbamimidoylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methoxy]-N-[(3-fluorophenyl)methyl]benzamide |
| SMILES | [H]/N=C(\N)c1ccc(N2CC(COc3cccc(C(=O)NCc4cccc(F)c4)c3)OC2=O)cc1 |
| InChI | InChI=1S/C25H23FN4O4/c26-19-5-1-3-16(11-19)13-29-24(31)18-4-2-6-21(12-18)33-15-22-14-30(25(32)34-22)20-9-7-17(8-10-20)23(27)28/h1-12,22H,13-15H2,(H3,27,28)(H,29,31) |
| InChIKey | JHMFQVRFTAKTME-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|