C17H14N2O7 — CID 11405654
4-[[3-(4-nitrophenyl)-2-oxo-1,3-oxazolidin-5-yl]methoxy]benzoic acid (PubChem CID 11405654) has the molecular formula C17H14N2O7 and a molecular weight of 358.31 g/mol. Its IUPAC name is 4-[[3-(4-nitrophenyl)-2-oxo-1,3-oxazolidin-5-yl]methoxy]benzoic acid.
| Compound Name | 4-[[3-(4-nitrophenyl)-2-oxo-1,3-oxazolidin-5-yl]methoxy]benzoic acid |
|---|---|
| PubChem CID | 11405654 |
| Molecular Formula | C17H14N2O7 |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 4-[[3-(4-nitrophenyl)-2-oxo-1,3-oxazolidin-5-yl]methoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(OCC2CN(c3ccc([N+](=O)[O-])cc3)C(=O)O2)cc1 |
| InChI | InChI=1S/C17H14N2O7/c20-16(21)11-1-7-14(8-2-11)25-10-15-9-18(17(22)26-15)12-3-5-13(6-4-12)19(23)24/h1-8,15H,9-10H2,(H,20,21) |
| InChIKey | YHQNRLATJSQJCS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|