C20H23NO4 — CID 139671317
5-[(4-butylphenoxy)methyl]-3-(4-hydroxyphenyl)-1,3-oxazolidin-2-one (PubChem CID 139671317) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is 5-[(4-butylphenoxy)methyl]-3-(4-hydroxyphenyl)-1,3-oxazolidin-2-one.
| Compound Name | 5-[(4-butylphenoxy)methyl]-3-(4-hydroxyphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139671317 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 5-[(4-butylphenoxy)methyl]-3-(4-hydroxyphenyl)-1,3-oxazolidin-2-one |
| SMILES | CCCCc1ccc(OCC2CN(c3ccc(O)cc3)C(=O)O2)cc1 |
| InChI | InChI=1S/C20H23NO4/c1-2-3-4-15-5-11-18(12-6-15)24-14-19-13-21(20(23)25-19)16-7-9-17(22)10-8-16/h5-12,19,22H,2-4,13-14H2,1H3 |
| InChIKey | YBGWJRWIELTYEM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |