About 3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-5-(methoxymethyl)-1,3-oxazolidin-2-one
3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-5-(methoxymethyl)-1,3-oxazolidin-2-one (PubChem CID 170608873) has the molecular formula C18H17Cl2NO4
and a molecular weight of 382.24 g/mol. Its IUPAC name is 3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-5-(methoxymethyl)-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-5-(methoxymethyl)-1,3-oxazolidin-2-one |
| PubChem CID | 170608873 |
| Molecular Formula | C18H17Cl2NO4 |
| Molecular Weight | 382.24 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-5-(methoxymethyl)-1,3-oxazolidin-2-one |
| SMILES | COCC1CN(c2ccc(OCc3c(Cl)cccc3Cl)cc2)C(=O)O1 |
| InChI | InChI=1S/C18H17Cl2NO4/c1-23-10-14-9-21(18(22)25-14)12-5-7-13(8-6-12)24-11-15-16(19)3-2-4-17(15)20/h2-8,14H,9-11H2,1H3 |
| InChIKey | VDVUJSYDKZHZGZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.24 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-5-(methoxymethyl)-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-5-(methoxymethyl)-1,3-oxazolidin-2-one?
The IUPAC name of 3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-5-(methoxymethyl)-1,3-oxazolidin-2-one (CID 170608873) is 3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-5-(methoxymethyl)-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-5-(methoxymethyl)-1,3-oxazolidin-2-one?
The canonical SMILES for 3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-5-(methoxymethyl)-1,3-oxazolidin-2-one is COCC1CN(c2ccc(OCc3c(Cl)cccc3Cl)cc2)C(=O)O1.
What is the InChIKey of 3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-5-(methoxymethyl)-1,3-oxazolidin-2-one?
The InChIKey is VDVUJSYDKZHZGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17Cl2NO4/c1-23-10-14-9-21(18(22)25-14)12-5-7-13(8-6-12)24-11-15-16(19)3-2-4-17(15)20/h2-8,14H,9-11H2,1H3.
What are the key properties of 3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-5-(methoxymethyl)-1,3-oxazolidin-2-one?
3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-5-(methoxymethyl)-1,3-oxazolidin-2-one has a molecular weight of 382.24 g/mol, XLogP of 4.54, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-5-(methoxymethyl)-1,3-oxazolidin-2-one is sourced from PubChem (CID 170608873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).