C15H18F3NO4 — CID 142257657
(5R)-5-(methoxymethyl)-3-[4-(4,4,4-trifluorobutoxy)phenyl]-1,3-oxazolidin-2-one (PubChem CID 142257657) has the molecular formula C15H18F3NO4 and a molecular weight of 333.31 g/mol. Its IUPAC name is (5R)-5-(methoxymethyl)-3-[4-(4,4,4-trifluorobutoxy)phenyl]-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-(methoxymethyl)-3-[4-(4,4,4-trifluorobutoxy)phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 142257657 |
| Molecular Formula | C15H18F3NO4 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (5R)-5-(methoxymethyl)-3-[4-(4,4,4-trifluorobutoxy)phenyl]-1,3-oxazolidin-2-one |
| SMILES | COC[C@H]1CN(c2ccc(OCCCC(F)(F)F)cc2)C(=O)O1 |
| InChI | InChI=1S/C15H18F3NO4/c1-21-10-13-9-19(14(20)23-13)11-3-5-12(6-4-11)22-8-2-7-15(16,17)18/h3-6,13H,2,7-10H2,1H3/t13-/m1/s1 |
| InChIKey | MMEYOQLFVREMPI-CYBMUJFWSA-N |
| XLogP | 3.38 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|