C15H21NO3 — CID 22368592
5-hexyl-3-(4-hydroxyphenyl)-1,3-oxazolidin-2-one (PubChem CID 22368592) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 5-hexyl-3-(4-hydroxyphenyl)-1,3-oxazolidin-2-one.
| Compound Name | 5-hexyl-3-(4-hydroxyphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 22368592 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 5-hexyl-3-(4-hydroxyphenyl)-1,3-oxazolidin-2-one |
| SMILES | CCCCCCC1CN(c2ccc(O)cc2)C(=O)O1 |
| InChI | InChI=1S/C15H21NO3/c1-2-3-4-5-6-14-11-16(15(18)19-14)12-7-9-13(17)10-8-12/h7-10,14,17H,2-6,11H2,1H3 |
| InChIKey | JIVBDCLYCPSGFH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|