C16H19FN2O2 — CID 59580233
2-fluoro-4-(5-hexyl-2-oxo-1,3-oxazolidin-3-yl)benzonitrile (PubChem CID 59580233) has the molecular formula C16H19FN2O2 and a molecular weight of 290.34 g/mol. Its IUPAC name is 2-fluoro-4-(5-hexyl-2-oxo-1,3-oxazolidin-3-yl)benzonitrile.
| Compound Name | 2-fluoro-4-(5-hexyl-2-oxo-1,3-oxazolidin-3-yl)benzonitrile |
|---|---|
| PubChem CID | 59580233 |
| Molecular Formula | C16H19FN2O2 |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 2-fluoro-4-(5-hexyl-2-oxo-1,3-oxazolidin-3-yl)benzonitrile |
| SMILES | CCCCCCC1CN(c2ccc(C#N)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C16H19FN2O2/c1-2-3-4-5-6-14-11-19(16(20)21-14)13-8-7-12(10-18)15(17)9-13/h7-9,14H,2-6,11H2,1H3 |
| InChIKey | CUHOGGGDEZNCDR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|