C18H24FNO2 — CID 23041388
2-fluoro-4-(4-heptyl-1,3-dioxan-2-yl)benzonitrile (PubChem CID 23041388) has the molecular formula C18H24FNO2 and a molecular weight of 305.39 g/mol. Its IUPAC name is 2-fluoro-4-(4-heptyl-1,3-dioxan-2-yl)benzonitrile.
| Compound Name | 2-fluoro-4-(4-heptyl-1,3-dioxan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 23041388 |
| Molecular Formula | C18H24FNO2 |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 2-fluoro-4-(4-heptyl-1,3-dioxan-2-yl)benzonitrile |
| SMILES | CCCCCCCC1CCOC(c2ccc(C#N)c(F)c2)O1 |
| InChI | InChI=1S/C18H24FNO2/c1-2-3-4-5-6-7-16-10-11-21-18(22-16)14-8-9-15(13-20)17(19)12-14/h8-9,12,16,18H,2-7,10-11H2,1H3 |
| InChIKey | AVDGGYVPSCLGHJ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|