C20H32O2 — CID 23041374
4-pentyl-2-(4-pentylphenyl)-1,3-dioxane (PubChem CID 23041374) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is 4-pentyl-2-(4-pentylphenyl)-1,3-dioxane.
| Compound Name | 4-pentyl-2-(4-pentylphenyl)-1,3-dioxane |
|---|---|
| PubChem CID | 23041374 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 4-pentyl-2-(4-pentylphenyl)-1,3-dioxane |
| SMILES | CCCCCc1ccc(C2OCCC(CCCCC)O2)cc1 |
| InChI | InChI=1S/C20H32O2/c1-3-5-7-9-17-11-13-18(14-12-17)20-21-16-15-19(22-20)10-8-6-4-2/h11-14,19-20H,3-10,15-16H2,1-2H3 |
| InChIKey | ROJFMPUUMHVNLM-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|