C15H22O2 — CID 13289082
4-hexyl-2-phenyl-1,3-dioxolane (PubChem CID 13289082) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 4-hexyl-2-phenyl-1,3-dioxolane.
| Compound Name | 4-hexyl-2-phenyl-1,3-dioxolane |
|---|---|
| PubChem CID | 13289082 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 4-hexyl-2-phenyl-1,3-dioxolane |
| SMILES | CCCCCCC1COC(c2ccccc2)O1 |
| InChI | InChI=1S/C15H22O2/c1-2-3-4-8-11-14-12-16-15(17-14)13-9-6-5-7-10-13/h5-7,9-10,14-15H,2-4,8,11-12H2,1H3 |
| InChIKey | VXKNNLXWPVFMPB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|