C10H12O3 — CID 10726056
[(4S)-2-phenyl-1,3-dioxolan-4-yl]methanol (PubChem CID 10726056) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is [(4S)-2-phenyl-1,3-dioxolan-4-yl]methanol.
| Compound Name | [(4S)-2-phenyl-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 10726056 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | [(4S)-2-phenyl-1,3-dioxolan-4-yl]methanol |
| SMILES | OC[C@H]1COC(c2ccccc2)O1 |
| InChI | InChI=1S/C10H12O3/c11-6-9-7-12-10(13-9)8-4-2-1-3-5-8/h1-5,9-11H,6-7H2/t9-,10?/m0/s1 |
| InChIKey | AUDDNHGBAJNKEH-RGURZIINSA-N |
| XLogP | 1.09 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |