C13H22NO5P — CID 161032649
aminophosphonous acid;4-(2-phenyl-1,3-dioxolan-4-yl)butan-1-ol (PubChem CID 161032649) has the molecular formula C13H22NO5P and a molecular weight of 303.29 g/mol. Its IUPAC name is aminophosphonous acid;4-(2-phenyl-1,3-dioxolan-4-yl)butan-1-ol.
| Compound Name | aminophosphonous acid;4-(2-phenyl-1,3-dioxolan-4-yl)butan-1-ol |
|---|---|
| PubChem CID | 161032649 |
| Molecular Formula | C13H22NO5P |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | aminophosphonous acid;4-(2-phenyl-1,3-dioxolan-4-yl)butan-1-ol |
| SMILES | NP(O)O.OCCCCC1COC(c2ccccc2)O1 |
| InChI | InChI=1S/C13H18O3.H4NO2P/c14-9-5-4-8-12-10-15-13(16-12)11-6-2-1-3-7-11;1-4(2)3/h1-3,6-7,12-14H,4-5,8-10H2;2-3H,1H2 |
| InChIKey | TZVCIWKYTWSEFL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|