C12H15NO4 — CID 21306105
N-hydroxy-N-methyl-2-(2-phenyl-1,3-dioxolan-4-yl)acetamide (PubChem CID 21306105) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is N-hydroxy-N-methyl-2-(2-phenyl-1,3-dioxolan-4-yl)acetamide.
| Compound Name | N-hydroxy-N-methyl-2-(2-phenyl-1,3-dioxolan-4-yl)acetamide |
|---|---|
| PubChem CID | 21306105 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | N-hydroxy-N-methyl-2-(2-phenyl-1,3-dioxolan-4-yl)acetamide |
| SMILES | CN(O)C(=O)CC1COC(c2ccccc2)O1 |
| InChI | InChI=1S/C12H15NO4/c1-13(15)11(14)7-10-8-16-12(17-10)9-5-3-2-4-6-9/h2-6,10,12,15H,7-8H2,1H3 |
| InChIKey | XYHPYTYZQUWDBL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|