C14H18O3 — CID 134360383
4-(2-phenyl-1,3-dioxan-4-yl)butan-2-one (PubChem CID 134360383) has the molecular formula C14H18O3 and a molecular weight of 234.30 g/mol. Its IUPAC name is 4-(2-phenyl-1,3-dioxan-4-yl)butan-2-one.
| Compound Name | 4-(2-phenyl-1,3-dioxan-4-yl)butan-2-one |
|---|---|
| PubChem CID | 134360383 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 4-(2-phenyl-1,3-dioxan-4-yl)butan-2-one |
| SMILES | CC(=O)CCC1CCOC(c2ccccc2)O1 |
| InChI | InChI=1S/C14H18O3/c1-11(15)7-8-13-9-10-16-14(17-13)12-5-3-2-4-6-12/h2-6,13-14H,7-10H2,1H3 |
| InChIKey | YFPWZXZVUWOLFY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |