C14H18O4 — CID 163610147
4-(oxiran-2-ylmethoxymethyl)-2-phenyl-1,3-dioxane (PubChem CID 163610147) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is 4-(oxiran-2-ylmethoxymethyl)-2-phenyl-1,3-dioxane.
| Compound Name | 4-(oxiran-2-ylmethoxymethyl)-2-phenyl-1,3-dioxane |
|---|---|
| PubChem CID | 163610147 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 4-(oxiran-2-ylmethoxymethyl)-2-phenyl-1,3-dioxane |
| SMILES | c1ccc(C2OCCC(COCC3CO3)O2)cc1 |
| InChI | InChI=1S/C14H18O4/c1-2-4-11(5-3-1)14-16-7-6-12(18-14)8-15-9-13-10-17-13/h1-5,12-14H,6-10H2 |
| InChIKey | HFFBPNHNQDRNQO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|