C12H17NO3 — CID 53421244
O-[2-(2-phenyl-1,3-dioxan-4-yl)ethyl]hydroxylamine (PubChem CID 53421244) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is O-[2-(2-phenyl-1,3-dioxan-4-yl)ethyl]hydroxylamine.
| Compound Name | O-[2-(2-phenyl-1,3-dioxan-4-yl)ethyl]hydroxylamine |
|---|---|
| PubChem CID | 53421244 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | O-[2-(2-phenyl-1,3-dioxan-4-yl)ethyl]hydroxylamine |
| SMILES | NOCCC1CCOC(c2ccccc2)O1 |
| InChI | InChI=1S/C12H17NO3/c13-15-9-7-11-6-8-14-12(16-11)10-4-2-1-3-5-10/h1-5,11-12H,6-9,13H2 |
| InChIKey | CVLUOQVVWFPWDY-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|