C15H20O4 — CID 53306704
ethyl 3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propanoate (PubChem CID 53306704) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is ethyl 3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propanoate.
| Compound Name | ethyl 3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propanoate |
|---|---|
| PubChem CID | 53306704 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | ethyl 3-[(2S,4R)-2-phenyl-1,3-dioxan-4-yl]propanoate |
| SMILES | CCOC(=O)CC[C@@H]1CCO[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C15H20O4/c1-2-17-14(16)9-8-13-10-11-18-15(19-13)12-6-4-3-5-7-12/h3-7,13,15H,2,8-11H2,1H3/t13-,15+/m1/s1 |
| InChIKey | CYYGRCANZGRWHJ-HIFRSBDPSA-N |
| XLogP | 2.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |