C20H34O3Si — CID 16688961
[(2S,4S)-2-phenyl-1,3-dioxan-4-yl]methoxy-tri(propan-2-yl)silane (PubChem CID 16688961) has the molecular formula C20H34O3Si and a molecular weight of 350.57 g/mol. Its IUPAC name is [(2S,4S)-2-phenyl-1,3-dioxan-4-yl]methoxy-tri(propan-2-yl)silane.
| Compound Name | [(2S,4S)-2-phenyl-1,3-dioxan-4-yl]methoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 16688961 |
| Molecular Formula | C20H34O3Si |
| Molecular Weight | 350.57 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | [(2S,4S)-2-phenyl-1,3-dioxan-4-yl]methoxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OC[C@@H]1CCO[C@H](c2ccccc2)O1)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H34O3Si/c1-15(2)24(16(3)4,17(5)6)22-14-19-12-13-21-20(23-19)18-10-8-7-9-11-18/h7-11,15-17,19-20H,12-14H2,1-6H3/t19-,20-/m0/s1 |
| InChIKey | RBKRFXLMJIAPGM-PMACEKPBSA-N |
| XLogP | 5.68 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.57 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|