C19H26O3 — CID 88986088
(2S,4S)-4-[[(2R,6S)-6-ethyl-4-methylideneoxan-2-yl]methyl]-2-phenyl-1,3-dioxane (PubChem CID 88986088) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is (2S,4S)-4-[[(2R,6S)-6-ethyl-4-methylideneoxan-2-yl]methyl]-2-phenyl-1,3-dioxane.
| Compound Name | (2S,4S)-4-[[(2R,6S)-6-ethyl-4-methylideneoxan-2-yl]methyl]-2-phenyl-1,3-dioxane |
|---|---|
| PubChem CID | 88986088 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (2S,4S)-4-[[(2R,6S)-6-ethyl-4-methylideneoxan-2-yl]methyl]-2-phenyl-1,3-dioxane |
| SMILES | C=C1C[C@H](C[C@@H]2CCO[C@H](c3ccccc3)O2)O[C@@H](CC)C1 |
| InChI | InChI=1S/C19H26O3/c1-3-16-11-14(2)12-18(21-16)13-17-9-10-20-19(22-17)15-7-5-4-6-8-15/h4-8,16-19H,2-3,9-13H2,1H3/t16-,17-,18+,19-/m0/s1 |
| InChIKey | XDKNUFKTAZRWJV-OKYOBFRVSA-N |
| XLogP | 4.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|