C16H24O3 — CID 23041443
2-(4-butoxyphenyl)-4-ethyl-1,3-dioxane (PubChem CID 23041443) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-4-ethyl-1,3-dioxane.
| Compound Name | 2-(4-butoxyphenyl)-4-ethyl-1,3-dioxane |
|---|---|
| PubChem CID | 23041443 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2-(4-butoxyphenyl)-4-ethyl-1,3-dioxane |
| SMILES | CCCCOc1ccc(C2OCCC(CC)O2)cc1 |
| InChI | InChI=1S/C16H24O3/c1-3-5-11-17-15-8-6-13(7-9-15)16-18-12-10-14(4-2)19-16/h6-9,14,16H,3-5,10-12H2,1-2H3 |
| InChIKey | BQQJJLPUOBBESO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|