C19H30O3 — CID 23041609
2-(4-butoxyphenyl)-4-pentyl-1,3-dioxane (PubChem CID 23041609) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-4-pentyl-1,3-dioxane.
| Compound Name | 2-(4-butoxyphenyl)-4-pentyl-1,3-dioxane |
|---|---|
| PubChem CID | 23041609 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 2-(4-butoxyphenyl)-4-pentyl-1,3-dioxane |
| SMILES | CCCCCC1CCOC(c2ccc(OCCCC)cc2)O1 |
| InChI | InChI=1S/C19H30O3/c1-3-5-7-8-18-13-15-21-19(22-18)16-9-11-17(12-10-16)20-14-6-4-2/h9-12,18-19H,3-8,13-15H2,1-2H3 |
| InChIKey | YHWFUENZTQGOAH-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|