C13H19NO — CID 83218632
2-ethyl-5-phenyl-1,4-oxazepane (PubChem CID 83218632) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 2-ethyl-5-phenyl-1,4-oxazepane.
| Compound Name | 2-ethyl-5-phenyl-1,4-oxazepane |
|---|---|
| PubChem CID | 83218632 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 2-ethyl-5-phenyl-1,4-oxazepane |
| SMILES | CCC1CNC(c2ccccc2)CCO1 |
| InChI | InChI=1S/C13H19NO/c1-2-12-10-14-13(8-9-15-12)11-6-4-3-5-7-11/h3-7,12-14H,2,8-10H2,1H3 |
| InChIKey | SLMROWPUAKZXDD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |