C18H22N2O2 — CID 157254746
acetic acid;2,5-diphenylpiperazine (PubChem CID 157254746) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is acetic acid;2,5-diphenylpiperazine.
| Compound Name | acetic acid;2,5-diphenylpiperazine |
|---|---|
| PubChem CID | 157254746 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | acetic acid;2,5-diphenylpiperazine |
| SMILES | CC(=O)O.c1ccc(C2CNC(c3ccccc3)CN2)cc1 |
| InChI | InChI=1S/C16H18N2.C2H4O2/c1-3-7-13(8-4-1)15-11-18-16(12-17-15)14-9-5-2-6-10-14;1-2(3)4/h1-10,15-18H,11-12H2;1H3,(H,3,4) |
| InChIKey | AWTJGCJSGUZJPR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |