C14H24N4 — CID 10901007
2-phenyl-1,4,7,10-tetrazacyclododecane (PubChem CID 10901007) has the molecular formula C14H24N4 and a molecular weight of 248.37 g/mol. Its IUPAC name is 2-phenyl-1,4,7,10-tetrazacyclododecane.
| Compound Name | 2-phenyl-1,4,7,10-tetrazacyclododecane |
|---|---|
| PubChem CID | 10901007 |
| Molecular Formula | C14H24N4 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 2-phenyl-1,4,7,10-tetrazacyclododecane |
| SMILES | c1ccc(C2CNCCNCCNCCN2)cc1 |
| InChI | InChI=1S/C14H24N4/c1-2-4-13(5-3-1)14-12-17-9-8-15-6-7-16-10-11-18-14/h1-5,14-18H,6-12H2 |
| InChIKey | BDGODZSIIUFSSF-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |