About 2-pyridin-3-ylpiperazine
2-pyridin-3-ylpiperazine (PubChem CID 3872289) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is 2-pyridin-3-ylpiperazine.
Molecular Properties
| Compound Name | 2-pyridin-3-ylpiperazine |
| PubChem CID | 3872289 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 2-pyridin-3-ylpiperazine |
| SMILES | c1cncc(C2CNCCN2)c1 |
| InChI | InChI=1S/C9H13N3/c1-2-8(6-10-3-1)9-7-11-4-5-12-9/h1-3,6,9,11-12H,4-5,7H2 |
| InChIKey | CGUDKJYHYOYXAQ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-pyridin-3-ylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-3-ylpiperazine?
The IUPAC name of 2-pyridin-3-ylpiperazine (CID 3872289) is 2-pyridin-3-ylpiperazine.
What is the SMILES notation for 2-pyridin-3-ylpiperazine?
The canonical SMILES for 2-pyridin-3-ylpiperazine is c1cncc(C2CNCCN2)c1.
What is the InChIKey of 2-pyridin-3-ylpiperazine?
The InChIKey is CGUDKJYHYOYXAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3/c1-2-8(6-10-3-1)9-7-11-4-5-12-9/h1-3,6,9,11-12H,4-5,7H2.
What are the key properties of 2-pyridin-3-ylpiperazine?
2-pyridin-3-ylpiperazine has a molecular weight of 163.22 g/mol, XLogP of 0.32, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-3-ylpiperazine is sourced from PubChem (CID 3872289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).