About 3-piperidin-4-ylpyridine;dihydrochloride
3-piperidin-4-ylpyridine;dihydrochloride (PubChem CID 21192973) has the molecular formula C10H16Cl2N2
and a molecular weight of 235.16 g/mol. Its IUPAC name is 3-piperidin-4-ylpyridine;dihydrochloride.
Molecular Properties
| Compound Name | 3-piperidin-4-ylpyridine;dihydrochloride |
| PubChem CID | 21192973 |
| Molecular Formula | C10H16Cl2N2 |
| Molecular Weight | 235.16 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 3-piperidin-4-ylpyridine;dihydrochloride |
| SMILES | Cl.Cl.c1cncc(C2CCNCC2)c1 |
| InChI | InChI=1S/C10H14N2.2ClH/c1-2-10(8-12-5-1)9-3-6-11-7-4-9;;/h1-2,5,8-9,11H,3-4,6-7H2;2*1H |
| InChIKey | PUOFTXQLJPYTRT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.16 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-piperidin-4-ylpyridine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-piperidin-4-ylpyridine;dihydrochloride?
The IUPAC name of 3-piperidin-4-ylpyridine;dihydrochloride (CID 21192973) is 3-piperidin-4-ylpyridine;dihydrochloride.
What is the SMILES notation for 3-piperidin-4-ylpyridine;dihydrochloride?
The canonical SMILES for 3-piperidin-4-ylpyridine;dihydrochloride is Cl.Cl.c1cncc(C2CCNCC2)c1.
What is the InChIKey of 3-piperidin-4-ylpyridine;dihydrochloride?
The InChIKey is PUOFTXQLJPYTRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2.2ClH/c1-2-10(8-12-5-1)9-3-6-11-7-4-9;;/h1-2,5,8-9,11H,3-4,6-7H2;2*1H.
What are the key properties of 3-piperidin-4-ylpyridine;dihydrochloride?
3-piperidin-4-ylpyridine;dihydrochloride has a molecular weight of 235.16 g/mol, XLogP of 2.39, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-piperidin-4-ylpyridine;dihydrochloride is sourced from PubChem (CID 21192973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).