C11H14N2O4 — CID 45156454
oxalic acid;3-pyrrolidin-2-ylpyridine (PubChem CID 45156454) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is oxalic acid;3-pyrrolidin-2-ylpyridine.
| Compound Name | oxalic acid;3-pyrrolidin-2-ylpyridine |
|---|---|
| PubChem CID | 45156454 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | oxalic acid;3-pyrrolidin-2-ylpyridine |
| SMILES | O=C(O)C(=O)O.c1cncc(C2CCCN2)c1 |
| InChI | InChI=1S/C9H12N2.C2H2O4/c1-3-8(7-10-5-1)9-4-2-6-11-9;3-1(4)2(5)6/h1,3,5,7,9,11H,2,4,6H2;(H,3,4)(H,5,6) |
| InChIKey | RZWPCSUSDGUGRC-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|